CAS 4779-31-1 appears in our catalog under these names: N-Carbobenzyloxy-L-aspartic Acid 1-Benzyl Ester, N-Cbz-L-aspartic acid 1-benzyl ester, Z–Asp–OBzl, N-Benzyloxycarbonyl-L-aspartic acid benzyl ester, 95% , Cbz-Asp-OBzl 97%. Offered by: TRC, Biosynth, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed. Available pack sizes: 1g, 2,5g, 5g, 50g, 25g, 100g, 500g, 250g.
(3S)-4-oxo-4-phenylmethoxy-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 4779-31-1) is a chemical compound with the molecular formula C19H19NO6 and a molecular weight of 357.4 g/mol. IUPAC name: (3S)-4-oxo-4-phenylmethoxy-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: UYOZWZKJQRBZRH-INIZCTEOSA-N.
| Molecular formula | C19H19NO6 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (3S)-4-oxo-4-phenylmethoxy-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | UYOZWZKJQRBZRH-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CC(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)