cas: 49671-76-3 — see every product listed under this CAS number, including other names
ZLN005, 99.92% (CAS 49671-76-3) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 100 mg, 10 mg, 25 mg, 50 mg, 5 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-17538-10mM/1mL |
| cas | 49671-76-3 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 333.62 Pln | |
| MedChemExpress | 100 mg | 1750.04 Pln | |
| MedChemExpress | 10 mg | 435.79 Pln | |
| MedChemExpress | 25 mg | 760.87 Pln | |
| MedChemExpress | 50 mg | 1141.68 Pln | |
| MedChemExpress | 5 mg | 315.05 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.92% |
2-(4-tert-butylphenyl)-1H-benzimidazole (CAS 49671-76-3) is a chemical compound with the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-1H-benzimidazole. InChIKey: LQUNNCQSFFKSSK-UHFFFAOYSA-N.
| Molecular formula | C17H18N2 |
|---|---|
| Molecular weight | 250.34 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-1H-benzimidazole |
| InChIKey | LQUNNCQSFFKSSK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)