ZLN005-d4, 99%, 99%
cas: 2410443-42-2 — see every product listed under this CAS number, including other names
ZLN005-d4, 99%, 99% (CAS 2410443-42-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch130Z09-1mg |
| cas | 2410443-42-2 |
| size | 1mg |
| availability | 0.005g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 3251.60 Pln | |
| Chemat | 5mg | 6942.80 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-(4-tert-butylphenyl)-4,5,6,7-tetradeuterio-1H-benzimidazole (CAS 2410443-42-2) is a chemical compound with the molecular formula C17H18N2 and a molecular weight of 254.36 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-4,5,6,7-tetradeuterio-1H-benzimidazole. InChIKey: LQUNNCQSFFKSSK-UGWFXTGHSA-N.
| Molecular formula | C17H18N2 |
|---|---|
| Molecular weight | 254.36 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-4,5,6,7-tetradeuterio-1H-benzimidazole |
| InChIKey | LQUNNCQSFFKSSK-UGWFXTGHSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])NC(=N2)C3=CC=C(C=C3)C(C)(C)C)[2H])[2H] |
Computed by PubChem (NCBI)