cas: 263389-54-4 — see every product listed under this CAS number, including other names
a-Tosyl-(4-methoxybenzyl) isocyanide 95% (CAS 263389-54-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A301512-100mg |
| cas | 263389-54-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 960.00 Pln | |
| Ambeed | 5g | 2767.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A301512 |
1-[isocyano-(4-methoxyphenyl)methyl]sulfonyl-4-methylbenzene (CAS 263389-54-4) is a chemical compound with the molecular formula C16H15NO3S and a molecular weight of 301.4 g/mol. IUPAC name: 1-[isocyano-(4-methoxyphenyl)methyl]sulfonyl-4-methylbenzene. InChIKey: QIJRGVGFTZWYNF-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3S |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 1-[isocyano-(4-methoxyphenyl)methyl]sulfonyl-4-methylbenzene |
| InChIKey | QIJRGVGFTZWYNF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC=C(C=C2)OC)[N+]#[C-] |
Computed by PubChem (NCBI)