cas: 29270-30-2 — see every product listed under this CAS number, including other names
alpha-Bromo-2-chlorophenylacetic Acid, >98.0%(GC)(T) (CAS 29270-30-2) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B2950-25G |
| cas | 29270-30-2 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 193.59 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2-bromo-2-(2-chlorophenyl)acetic acid (CAS 29270-30-2) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 2-bromo-2-(2-chlorophenyl)acetic acid. InChIKey: XHAPROULWZYBGA-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 2-bromo-2-(2-chlorophenyl)acetic acid |
| InChIKey | XHAPROULWZYBGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)Br)Cl |
Computed by PubChem (NCBI)