cas: 1228631-19-3 — see every product listed under this CAS number, including other names
benzyl 3,5-dioxopiperidine-1-carboxylate (CAS 1228631-19-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111JMU-100mg |
| cas | 1228631-19-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1014.80 Pln | |
| Chemat | 250mg | 1576.40 Pln | |
| Chemat | 500mg | 2589.20 Pln | |
| Chemat | 1g | 3851.60 Pln | |
| Chemat | 5g | 11430.80 Pln |
| delivery time | 3 weeks |
|---|
Benzyl 3,5-dioxopiperidine-1-carboxylate (CAS 1228631-19-3) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: benzyl 3,5-dioxopiperidine-1-carboxylate. InChIKey: LWXKJIHFJCWJGM-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | benzyl 3,5-dioxopiperidine-1-carboxylate |
| InChIKey | LWXKJIHFJCWJGM-UHFFFAOYSA-N |
| SMILES | C1C(=O)CN(CC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)