cas: 291528-32-0 — see every product listed under this CAS number, including other names
benzyl 4-fluoro-3-nitrobenzoate, 95%, 95% (CAS 291528-32-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AMVX-100mg |
| cas | 291528-32-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl 4-fluoro-3-nitrobenzoate (CAS 291528-32-0) is a chemical compound with the molecular formula C14H10FNO4 and a molecular weight of 275.23 g/mol. IUPAC name: benzyl 4-fluoro-3-nitrobenzoate. InChIKey: JTJITTDUVBATOW-UHFFFAOYSA-N.
| Molecular formula | C14H10FNO4 |
|---|---|
| Molecular weight | 275.23 g/mol |
| IUPAC name | benzyl 4-fluoro-3-nitrobenzoate |
| InChIKey | JTJITTDUVBATOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC(=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)