CAS 1820604-19-0 is the registry number for Benzyl 2-fluoro-6-nitrobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Benzyl 2-fluoro-6-nitrobenzoate (CAS 1820604-19-0) is a chemical compound with the molecular formula C14H10FNO4 and a molecular weight of 275.23 g/mol. IUPAC name: benzyl 2-fluoro-6-nitrobenzoate. InChIKey: TXLRWJUKZQXBCD-UHFFFAOYSA-N.
| Molecular formula | C14H10FNO4 |
|---|---|
| Molecular weight | 275.23 g/mol |
| IUPAC name | benzyl 2-fluoro-6-nitrobenzoate |
| InChIKey | TXLRWJUKZQXBCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=C(C=CC=C2F)[N+](=O)[O-] |
Computed by PubChem (NCBI)