Products 291528-32-0
CAS 291528-32-0 appears in our catalog under these names: 4-Fluoro-3-nitrobenzoic acid benzyl ester, 95%, Benzyl 4-fluoro-3-nitrobenzoate, 97%, Benzyl 4-fluoro-3-nitrobenzoate, benzyl 4-fluoro-3-nitrobenzoate, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Benzyl 4-fluoro-3-nitrobenzoate (CAS 291528-32-0) is a chemical compound with the molecular formula C14H10FNO4 and a molecular weight of 275.23 g/mol. IUPAC name: benzyl 4-fluoro-3-nitrobenzoate. InChIKey: JTJITTDUVBATOW-UHFFFAOYSA-N.
| Molecular formula | C14H10FNO4 |
|---|---|
| Molecular weight | 275.23 g/mol |
| IUPAC name | benzyl 4-fluoro-3-nitrobenzoate |
| InChIKey | JTJITTDUVBATOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC(=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)