CAS 1820650-98-3 is the registry number for methyl 3-fluoro-5-(2-nitrophenyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-fluoro-5-(2-nitrophenyl)benzoate (CAS 1820650-98-3) is a chemical compound with the molecular formula C14H10FNO4 and a molecular weight of 275.23 g/mol. IUPAC name: methyl 3-fluoro-5-(2-nitrophenyl)benzoate. InChIKey: DHIKNRBGQROOEG-UHFFFAOYSA-N.
| Molecular formula | C14H10FNO4 |
|---|---|
| Molecular weight | 275.23 g/mol |
| IUPAC name | methyl 3-fluoro-5-(2-nitrophenyl)benzoate |
| InChIKey | DHIKNRBGQROOEG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C2=CC=CC=C2[N+](=O)[O-])F |
Computed by PubChem (NCBI)