Products 1261903-43-8

CAS 1261903-43-8 is the registry number for 3-(3-Fluoro-4-methylphenyl)-5-nitrobenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-(3-fluoro-4-methylphenyl)-5-nitrobenzoic acid (CAS 1261903-43-8) is a chemical compound with the molecular formula C14H10FNO4 and a molecular weight of 275.23 g/mol. IUPAC name: 3-(3-fluoro-4-methylphenyl)-5-nitrobenzoic acid. InChIKey: SGICNTDEGPQQSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10FNO4
Molecular weight275.23 g/mol
IUPAC name3-(3-fluoro-4-methylphenyl)-5-nitrobenzoic acid
InChIKeySGICNTDEGPQQSZ-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C2=CC(=CC(=C2)[N+](=O)[O-])C(=O)O)F

Computed by PubChem (NCBI)