cas: 98648-05-6 — see every product listed under this CAS number, including other names
benzyl N-(6-oxohexyl)carbamate 97% (CAS 98648-05-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A186294-250mg |
| cas | 98648-05-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1460.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A186294 |
Benzyl N-(6-oxohexyl)carbamate (CAS 98648-05-6) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: benzyl N-(6-oxohexyl)carbamate. InChIKey: XPGMGPSEWHRDSL-UHFFFAOYSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | benzyl N-(6-oxohexyl)carbamate |
| InChIKey | XPGMGPSEWHRDSL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCCCCC=O |
Computed by PubChem (NCBI)