cas: 104719-63-3 — see every product listed under this CAS number, including other names
boc-d-glu(otbu)-oh, 98% (CAS 104719-63-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 250mg, 1g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F045433-5G |
| cas | 104719-63-3 |
| size | 5g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 560.24 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 410.00 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2R)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 104719-63-3) is a chemical compound with the molecular formula C14H25NO6 and a molecular weight of 303.35 g/mol. IUPAC name: (2R)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: YGSRAYJBEREVRB-SECBINFHSA-N.
| Molecular formula | C14H25NO6 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | (2R)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | YGSRAYJBEREVRB-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)