cas: 1810070-30-4 — see every product listed under this CAS number, including other names
cis-2-((tert-Butoxycarbonyl)amino)cyclopropanecarboxylic acid 95% (CAS 1810070-30-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A512282-100mg |
| cas | 1810070-30-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 737.50 Pln | |
| Ambeed | 1g | 1816.62 Pln | |
| Ambeed | 5g | 5337.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A512282 |
Cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid (CAS 1810070-30-4) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid. InChIKey: NOZMNADEEKQWGO-NTSWFWBYSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid |
| InChIKey | NOZMNADEEKQWGO-NTSWFWBYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)