cas: 1810070-30-4 — see every product listed under this CAS number, including other names
REL-(1S,2R)-2-([(TERT-BUTOXY)CARBONYL]AMINO)CYCLOPROPANE-1-CARBOXYLIC ACID, 98% (CAS 1810070-30-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F504805-100MG |
| cas | 1810070-30-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 841.39 Pln | |
| Fluorochem | 1g | 1768.15 Pln | |
| Fluorochem | 5g | 5220.05 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid (CAS 1810070-30-4) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid. InChIKey: NOZMNADEEKQWGO-NTSWFWBYSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid |
| InChIKey | NOZMNADEEKQWGO-NTSWFWBYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)