cas: 31420-52-7 — see every product listed under this CAS number, including other names
cis-2-(Methoxycarbonyl)cyclobutanecarboxylic acid 97% (CAS 31420-52-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A550276-100mg |
| cas | 31420-52-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 687.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A550276 |
Cis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid (CAS 31420-52-7) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: cis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid. InChIKey: DLSMGFKPSMYVFW-UHNVWZDZSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | cis-(1R,2S)-2-methoxycarbonylcyclobutane-1-carboxylic acid |
| InChIKey | DLSMGFKPSMYVFW-UHNVWZDZSA-N |
| SMILES | COC(=O)[C@H]1CC[C@H]1C(=O)O |
Computed by PubChem (NCBI)