Products 22267-35-2
CAS 22267-35-2 is the registry number for cis-3-Hydroxycyclohexanecarboxylic acid, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
Cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid (CAS 22267-35-2) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid. InChIKey: JBZDHFKPEDWWJC-RITPCOANSA-N.
| Molecular formula | C7H12O3 |
|---|---|
| Molecular weight | 144.17 g/mol |
| IUPAC name | cis-(1R,3S)-3-hydroxycyclohexane-1-carboxylic acid |
| InChIKey | JBZDHFKPEDWWJC-RITPCOANSA-N |
| SMILES | C1C[C@H](C[C@H](C1)O)C(=O)O |
Computed by PubChem (NCBI)