cas: 87813-06-7 — see every product listed under this CAS number, including other names
cis-Dimethyl 1-benzylpyrrolidine-3,4-dicarboxylate, 97%, 97% (CAS 87813-06-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H3TQ-100mg |
| cas | 87813-06-7 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 500mg | 414.80 Pln | |
| Chemat | 1g | 525.20 Pln | |
| Chemat | 5g | 1456.40 Pln | |
| Chemat | 10g | 2474.00 Pln | |
| Chemat | 25g | 5982.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Dimethyl (3R,4S)-1-benzylpyrrolidine-3,4-dicarboxylate (CAS 87813-06-7) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: dimethyl (3R,4S)-1-benzylpyrrolidine-3,4-dicarboxylate. InChIKey: JSRVVUSBZJFOJO-BETUJISGSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | dimethyl (3R,4S)-1-benzylpyrrolidine-3,4-dicarboxylate |
| InChIKey | JSRVVUSBZJFOJO-BETUJISGSA-N |
| SMILES | COC(=O)[C@@H]1CN(C[C@@H]1C(=O)OC)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)