cas: 87813-06-7 — see every product listed under this CAS number, including other names
cis-Dimethyl 1-benzylpyrrolidine-3,4-dicarboxylate, 98% (CAS 87813-06-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A384578-250mg |
| cas | 87813-06-7 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 734.02 Pln | |
| AmBeed | 5g | 3285.94 Pln | |
| AmBeed | 10g | 6163.36 Pln | |
| AmBeed | 25g | 10902.64 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Dimethyl (3R,4S)-1-benzylpyrrolidine-3,4-dicarboxylate (CAS 87813-06-7) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: dimethyl (3R,4S)-1-benzylpyrrolidine-3,4-dicarboxylate. InChIKey: JSRVVUSBZJFOJO-BETUJISGSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | dimethyl (3R,4S)-1-benzylpyrrolidine-3,4-dicarboxylate |
| InChIKey | JSRVVUSBZJFOJO-BETUJISGSA-N |
| SMILES | COC(=O)[C@@H]1CN(C[C@@H]1C(=O)OC)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)