cas: 1630907-23-1 — see every product listed under this CAS number, including other names
cyclobutanamine, 3-(2-fluoro-4-methoxyphenoxy)-, hydrochloride (1:1),trans-, 97%, 97% (CAS 1630907-23-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYUL-100mg |
| cas | 1630907-23-1 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 592.40 Pln | |
| Chemat | 500mg | 952.40 Pln | |
| Chemat | 1g | 1427.60 Pln | |
| Chemat | 5g | 4101.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(2-fluoro-4-methoxyphenoxy)cyclobutan-1-amine;hydrochloride (CAS 1630907-23-1) is a chemical compound with the molecular formula C11H15ClFNO2 and a molecular weight of 247.69 g/mol. IUPAC name: 3-(2-fluoro-4-methoxyphenoxy)cyclobutan-1-amine;hydrochloride. InChIKey: HBHLTSVEGOKIOF-UHFFFAOYSA-N.
| Molecular formula | C11H15ClFNO2 |
|---|---|
| Molecular weight | 247.69 g/mol |
| IUPAC name | 3-(2-fluoro-4-methoxyphenoxy)cyclobutan-1-amine;hydrochloride |
| InChIKey | HBHLTSVEGOKIOF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC2CC(C2)N)F.Cl |
Computed by PubChem (NCBI)