cas: 1630907-23-1 — see every product listed under this CAS number, including other names
trans-3-(2-Fluoro-4-methoxyphenoxy)cyclobutanamine hydrochloride, 97% (CAS 1630907-23-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A374073-10g |
| cas | 1630907-23-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 9795.94 Pln | |
| AmBeed | 5g | 7908.04 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(2-fluoro-4-methoxyphenoxy)cyclobutan-1-amine;hydrochloride (CAS 1630907-23-1) is a chemical compound with the molecular formula C11H15ClFNO2 and a molecular weight of 247.69 g/mol. IUPAC name: 3-(2-fluoro-4-methoxyphenoxy)cyclobutan-1-amine;hydrochloride. InChIKey: HBHLTSVEGOKIOF-UHFFFAOYSA-N.
| Molecular formula | C11H15ClFNO2 |
|---|---|
| Molecular weight | 247.69 g/mol |
| IUPAC name | 3-(2-fluoro-4-methoxyphenoxy)cyclobutan-1-amine;hydrochloride |
| InChIKey | HBHLTSVEGOKIOF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC2CC(C2)N)F.Cl |
Computed by PubChem (NCBI)