cas: 1263166-91-1 — see every product listed under this CAS number, including other names
endo-BCN-O-PNB 95% (CAS 1263166-91-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A756306-25mg |
| cas | 1263166-91-1 |
| size | 25mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 381.50 Pln | |
| Ambeed | 50mg | 448.25 Pln | |
| Ambeed | 100mg | 576.19 Pln | |
| Ambeed | 250mg | 1332.69 Pln | |
| Ambeed | 1g | 5098.50 Pln | |
| Ambeed | 5g | 17675.31 Pln | |
| Ambeed | 10g | 30001.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A756306 |
[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (4-nitrophenyl) carbonate (CAS 1263166-91-1) is a chemical compound with the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. IUPAC name: [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (4-nitrophenyl) carbonate. InChIKey: QXNXOXMDBLHIDB-XYPWUTKMSA-N.
| Molecular formula | C17H17NO5 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (4-nitrophenyl) carbonate |
| InChIKey | QXNXOXMDBLHIDB-XYPWUTKMSA-N |
| SMILES | C1C[C@@H]2[C@@H](C2COC(=O)OC3=CC=C(C=C3)[N+](=O)[O-])CCC#C1 |
Computed by PubChem (NCBI)