cas: 135334-14-4 — see every product listed under this CAS number, including other names
ethyl 2-(3-chlorophenyl)-2,2-difluoroacetate (CAS 135334-14-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117Z9P-100mg |
| cas | 135334-14-4 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 1g | 722.00 Pln | |
| Chemat | 5g | 1542.80 Pln |
| delivery time | 3 weeks |
|---|
Ethyl 2-(3-chlorophenyl)-2,2-difluoroacetate (CAS 135334-14-4) is a chemical compound with the molecular formula C10H9ClF2O2 and a molecular weight of 234.62 g/mol. IUPAC name: ethyl 2-(3-chlorophenyl)-2,2-difluoroacetate. InChIKey: JEZFHRLBCLCNEP-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2O2 |
|---|---|
| Molecular weight | 234.62 g/mol |
| IUPAC name | ethyl 2-(3-chlorophenyl)-2,2-difluoroacetate |
| InChIKey | JEZFHRLBCLCNEP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC(=CC=C1)Cl)(F)F |
Computed by PubChem (NCBI)