cas: 37041-30-8 — see every product listed under this CAS number, including other names
ethyl 4-chlorobenzo[h]quinoline-3-carboxylate (CAS 37041-30-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11VVPS-1g |
| cas | 37041-30-8 |
| size | 1g |
| availability | 8.71g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 4211.60 Pln | |
| Fluorochem | 1g | 6948.61 Pln |
| delivery time | 3 weeks |
|---|
Ethyl 4-chlorobenzo[h]quinoline-3-carboxylate (CAS 37041-30-8) is a chemical compound with the molecular formula C16H12ClNO2 and a molecular weight of 285.72 g/mol. IUPAC name: ethyl 4-chlorobenzo[h]quinoline-3-carboxylate. InChIKey: OUVDIUPLVZVEEN-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO2 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | ethyl 4-chlorobenzo[h]quinoline-3-carboxylate |
| InChIKey | OUVDIUPLVZVEEN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=C1Cl)C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)