exo-BCN-NHS carbonate, 95%
cas: 1493802-77-9 — see every product listed under this CAS number, including other names
exo-BCN-NHS carbonate, 95% (CAS 1493802-77-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg. Offered by: Ambeed, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1251282-100mg |
| cas | 1493802-77-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 921.06 Pln | |
| Ambeed | 250mg | 1638.62 Pln | |
| Ambeed | 1g | 4369.81 Pln | |
| Ambeed | 5g | 13759.31 Pln | |
| Fluorochem | 50mg | 404.04 Pln | |
| Fluorochem | 100mg | 591.48 Pln | |
| Fluorochem | 250mg | 935.11 Pln | |
| Fluorochem | 1g | 3257.20 Pln | |
| Fluorochem | 5g | 10962.82 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate (CAS 1493802-77-9) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate. InChIKey: SKTDJYHCSCYLQU-FOSCPWQOSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| InChIKey | SKTDJYHCSCYLQU-FOSCPWQOSA-N |
| SMILES | C1C[C@@H]2[C@@H](C2COC(=O)ON3C(=O)CCC3=O)CCC#C1 |
Computed by PubChem (NCBI)
Synonyms:
endo-BCN-NHS carbonate, exo-BCN-NHS carbonate, (1R,8S,9s)-Bicyclo[6.1.0]non-4-yn-9-ylmethyl Succinimidyl Carbonate, BCN-NHS, [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate, (1R,8S,9s)-Bicyclo[6.1.0]non-4-yn-9-ylmethyl N-succinimidyl carbonate, endo-BCN-OSu, exo-BCN-OSu, BCN-CO-NHS, (1R,8S,9s)-bicyclo[6.1.0]non-4-yn-9-ylmethylN-succinimide carbonate