Products 270065-52-6

CAS 270065-52-6 is the registry number for Cbz-pyr-oet, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

1-O-benzyl 2-O-ethyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate (CAS 270065-52-6) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: 1-O-benzyl 2-O-ethyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: RLGLAAVVDIZYTP-LBPRGKRZSA-N.

Identity
Molecular formulaC15H17NO5
Molecular weight291.30 g/mol
IUPAC name1-O-benzyl 2-O-ethyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate
InChIKeyRLGLAAVVDIZYTP-LBPRGKRZSA-N
SMILESCCOC(=O)[C@@H]1CCC(=O)N1C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)