Products 1674390-14-7

CAS 1674390-14-7 is the registry number for 3-(7,8-Dimethoxy-2-oxo-1,2-dihydro-3h-3-benzazepin-3-yl)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-(7,8-dimethoxy-2-oxo-1H-3-benzazepin-3-yl)propanoic acid (CAS 1674390-14-7) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: 3-(7,8-dimethoxy-2-oxo-1H-3-benzazepin-3-yl)propanoic acid. InChIKey: OPHMLRZIEGJAIR-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17NO5
Molecular weight291.30 g/mol
IUPAC name3-(7,8-dimethoxy-2-oxo-1H-3-benzazepin-3-yl)propanoic acid
InChIKeyOPHMLRZIEGJAIR-UHFFFAOYSA-N
SMILESCOC1=C(C=C2C=CN(C(=O)CC2=C1)CCC(=O)O)OC

Computed by PubChem (NCBI)