Products 1881290-43-2
CAS 1881290-43-2 is the registry number for 1-tert-butyl 7-methyl 2-hydroxy-1H-indole-1,7-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-O-tert-butyl 7-O-methyl 2-hydroxyindole-1,7-dicarboxylate (CAS 1881290-43-2) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: 1-O-tert-butyl 7-O-methyl 2-hydroxyindole-1,7-dicarboxylate. InChIKey: CCIAIWGAPHYPPP-UHFFFAOYSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | 1-O-tert-butyl 7-O-methyl 2-hydroxyindole-1,7-dicarboxylate |
| InChIKey | CCIAIWGAPHYPPP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(=CC2=C1C(=CC=C2)C(=O)OC)O |
Computed by PubChem (NCBI)