Products 899762-52-8

CAS 899762-52-8 is the registry number for 5-Oxo-1-[4-(propoxycarbonyl)phenyl]pyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-oxo-1-(4-propoxycarbonylphenyl)pyrrolidine-3-carboxylic acid (CAS 899762-52-8) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: 5-oxo-1-(4-propoxycarbonylphenyl)pyrrolidine-3-carboxylic acid. InChIKey: BOVXDZQCJJCKIU-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17NO5
Molecular weight291.30 g/mol
IUPAC name5-oxo-1-(4-propoxycarbonylphenyl)pyrrolidine-3-carboxylic acid
InChIKeyBOVXDZQCJJCKIU-UHFFFAOYSA-N
SMILESCCCOC(=O)C1=CC=C(C=C1)N2CC(CC2=O)C(=O)O

Computed by PubChem (NCBI)