h-ser-obzl.hcl, 95%
cas: 60022-62-0 — see every product listed under this CAS number, including other names
h-ser-obzl.hcl, 95% (CAS 60022-62-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F045367-1G |
| cas | 60022-62-0 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.06 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 143.72 Pln | |
| Fluorochem | 25g | 180.16 Pln | |
| Fluorochem | 100g | 544.62 Pln | |
| Fluorochem | 500g | 2153.43 Pln | |
| Fluorochem | 1kg | 4209.99 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 10g | 236.61 Pln | |
| BLDpharm | 25g | 269.93 Pln | |
| BLDpharm | 100g | 580.93 Pln | |
| BLDpharm | 500g | 2296.99 Pln | |
| BLDpharm | 1kg | 4235.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Benzyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride (CAS 60022-62-0) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: benzyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride. InChIKey: MGZWCDQAKCHOBX-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride |
| InChIKey | MGZWCDQAKCHOBX-FVGYRXGTSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Benzyl L-serinate--hydrogen chloride (1/1), L-Serine benzyl ester hydrochloride, H-Ser-OBzl.HCl, H-Ser-Obzl HCl, L-Serine benzyl ester HCl, L-Serine, phenylmethyl ester, hydrochloride, l-serine-benzyl ester-hcl, benzyl (2S)-2-amino-3-hydroxypropanoate hydrochloride, Benzyl L-serinate hydrochloride, serine benzyl ester hydrochloride