CAS 1173715-42-8 appears in our catalog under these names: hDHODH-IN-1/ 99.75% (existing batch purity), hDHODH–IN–1, Hdhodh-in-1, N-([1,1'-Biphenyl]-4-yl)-2-cyano-3-hydroxybut-2-enamide, 98%, 98%, hDHODH-IN-1, 99.90%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 25 mg.
(Z)-2-cyano-3-hydroxy-N-(4-phenylphenyl)but-2-enamide (CAS 1173715-42-8) is a chemical compound with the molecular formula C17H14N2O2 and a molecular weight of 278.30 g/mol. IUPAC name: (Z)-2-cyano-3-hydroxy-N-(4-phenylphenyl)but-2-enamide. InChIKey: MUVPBAIVOHJDOC-VBKFSLOCSA-N.
| Molecular formula | C17H14N2O2 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | (Z)-2-cyano-3-hydroxy-N-(4-phenylphenyl)but-2-enamide |
| InChIKey | MUVPBAIVOHJDOC-VBKFSLOCSA-N |
| SMILES | C/C(=C(\C#N)/C(=O)NC1=CC=C(C=C1)C2=CC=CC=C2)/O |
Computed by PubChem (NCBI)