cas: 78850-78-9 — see every product listed under this CAS number, including other names
m-(2-Fluorophenoxy)toluene , (CAS 78850-78-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RE4-250mg |
| cas | 78850-78-9 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 976.40 Pln |
| delivery time | 3 weeks |
|---|
1-fluoro-2-(3-methylphenoxy)benzene (CAS 78850-78-9) is a chemical compound with the molecular formula C13H11FO and a molecular weight of 202.22 g/mol. IUPAC name: 1-fluoro-2-(3-methylphenoxy)benzene. InChIKey: LTTPKDJFHJHNPA-UHFFFAOYSA-N.
| Molecular formula | C13H11FO |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | 1-fluoro-2-(3-methylphenoxy)benzene |
| InChIKey | LTTPKDJFHJHNPA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)OC2=CC=CC=C2F |
Computed by PubChem (NCBI)