cas: 78850-78-9 — see every product listed under this CAS number, including other names
m-(2-Fluorophenoxy)toluene (CAS 78850-78-9) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F0375-5G |
| cas | 78850-78-9 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 1028.04 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
1-fluoro-2-(3-methylphenoxy)benzene (CAS 78850-78-9) is a chemical compound with the molecular formula C13H11FO and a molecular weight of 202.22 g/mol. IUPAC name: 1-fluoro-2-(3-methylphenoxy)benzene. InChIKey: LTTPKDJFHJHNPA-UHFFFAOYSA-N.
| Molecular formula | C13H11FO |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | 1-fluoro-2-(3-methylphenoxy)benzene |
| InChIKey | LTTPKDJFHJHNPA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)OC2=CC=CC=C2F |
Computed by PubChem (NCBI)