cas: 1107627-14-4 — see every product listed under this CAS number, including other names
methyl 2-bromo-3-chlorobenzoate, 98%, 98% (CAS 1107627-14-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HBRK-100mg |
| cas | 1107627-14-4 |
| size | 100mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 25g | 880.40 Pln | |
| Chemat | 50g | 1374.80 Pln | |
| Chemat | 100g | 2382.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-bromo-3-chlorobenzoate (CAS 1107627-14-4) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: methyl 2-bromo-3-chlorobenzoate. InChIKey: DBKFYOHGPURQCZ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | methyl 2-bromo-3-chlorobenzoate |
| InChIKey | DBKFYOHGPURQCZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)Cl)Br |
Computed by PubChem (NCBI)