cas: 870244-28-3 — see every product listed under this CAS number, including other names
methyl 4-bromo-3-methylthieno[2,3-c]pyridine-2-carboxylate, 97%, 97% (CAS 870244-28-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IEBN-100mg |
| cas | 870244-28-3 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1461.20 Pln | |
| Chemat | 250mg | 2387.60 Pln | |
| Chemat | 500mg | 3938.00 Pln | |
| Chemat | 1g | 5877.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-bromo-3-methylthieno[2,3-c]pyridine-2-carboxylate (CAS 870244-28-3) is a chemical compound with the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. IUPAC name: methyl 4-bromo-3-methylthieno[2,3-c]pyridine-2-carboxylate. InChIKey: MUOYGRONALMVJQ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | methyl 4-bromo-3-methylthieno[2,3-c]pyridine-2-carboxylate |
| InChIKey | MUOYGRONALMVJQ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=CN=CC(=C12)Br)C(=O)OC |
Computed by PubChem (NCBI)