cas: 517870-19-8 — see every product listed under this CAS number, including other names
methyl 5-(3-methoxyphenyl)isoxazole-3-carboxylate, 96% (CAS 517870-19-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F495235-100MG |
| cas | 517870-19-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 500mg | 310.33 Pln | |
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 2.5g | 752.88 Pln | |
| Fluorochem | 5g | 997.58 Pln | |
| Fluorochem | 10g | 1622.36 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-(3-methoxyphenyl)-1,2-oxazole-3-carboxylate (CAS 517870-19-8) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: methyl 5-(3-methoxyphenyl)-1,2-oxazole-3-carboxylate. InChIKey: BUYQDAXEBRVQAB-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | methyl 5-(3-methoxyphenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | BUYQDAXEBRVQAB-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=NO2)C(=O)OC |
Computed by PubChem (NCBI)