CAS 2571-00-8 appears in our catalog under these names: p-Tolualdehyd-2,4-dinitrophenylhydrazone, p–Tolualdehyde 2,4–Dinitrophenylhydrazone, p-Tolualdehyde 2,4-Dinitrophenylhydrazone, >98.0%(T)(HPLC), (E)-1-(2,4-dinitrophenyl)-2-(4-methylbenzylidene)hydrazine, p-Tolualdehyde-DNPH. Offered by: Dr. Ehrenstorfer, GLPBio, TCI, Chemat, HPC Standards. Available pack sizes: 100mg, 1g, 5g, 10g, 1x100mg, 1x10ml, 1x1ml.
N-[(E)-(4-methylphenyl)methylideneamino]-2,4-dinitroaniline (CAS 2571-00-8) is a chemical compound with the molecular formula C14H12N4O4 and a molecular weight of 300.27 g/mol. IUPAC name: N-[(E)-(4-methylphenyl)methylideneamino]-2,4-dinitroaniline. InChIKey: KOMHUUXZDFABJZ-OQLLNIDSSA-N.
| Molecular formula | C14H12N4O4 |
|---|---|
| Molecular weight | 300.27 g/mol |
| IUPAC name | N-[(E)-(4-methylphenyl)methylideneamino]-2,4-dinitroaniline |
| InChIKey | KOMHUUXZDFABJZ-OQLLNIDSSA-N |
| SMILES | CC1=CC=C(C=C1)/C=N/NC2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)