cas: 3900-79-6 — see every product listed under this CAS number, including other names
p-Toluenesulfonyl acetone hydrazone, 95%, 95% (CAS 3900-79-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CAS0-250mg |
| cas | 3900-79-6 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 558.80 Pln | |
| Chemat | 10g | 904.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-methyl-N-(propan-2-ylideneamino)benzenesulfonamide (CAS 3900-79-6) is a chemical compound with the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. IUPAC name: 4-methyl-N-(propan-2-ylideneamino)benzenesulfonamide. InChIKey: XJXJLURHJAVZJI-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 4-methyl-N-(propan-2-ylideneamino)benzenesulfonamide |
| InChIKey | XJXJLURHJAVZJI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NN=C(C)C |
Computed by PubChem (NCBI)