CAS 1000-28-8 is the registry number for 1H,1H,2'H-Perfluorodipropyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
1,1,1,2,3,3-hexafluoro-3-(2,2,3,3,3-pentafluoropropoxy)propane (CAS 1000-28-8) is a chemical compound with the molecular formula C6H3F11O and a molecular weight of 300.07 g/mol. IUPAC name: 1,1,1,2,3,3-hexafluoro-3-(2,2,3,3,3-pentafluoropropoxy)propane. InChIKey: JOROOXPAFHWVRW-UHFFFAOYSA-N.
| Molecular formula | C6H3F11O |
|---|---|
| Molecular weight | 300.07 g/mol |
| IUPAC name | 1,1,1,2,3,3-hexafluoro-3-(2,2,3,3,3-pentafluoropropoxy)propane |
| InChIKey | JOROOXPAFHWVRW-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)F)(F)F)OC(C(C(F)(F)F)F)(F)F |
Computed by PubChem (NCBI)