CAS 423-46-1 appears in our catalog under these names: 2,2,3,3,4,4,5,5,6,6,6-Undecafluorohexan-1-ol, 97%, 1H,1H–Undecafluoro–1–hexanol, 1H,1H-Perfluorohexan-1-ol, 95%, 1H,1H-Perfluorohexan-1-ol, >95% (GC), 1H,1H-Undecafluoro-1-hexanol, >96.0%(GC). Offered by: AmBeed, GLPBio, Combi-blocks, TRC, TCI. Available pack sizes: 1g, 25g, 10g, 5g, 2,5g, 50mg, 100mg, 250mg.
2,2,3,3,4,4,5,5,6,6,6-undecafluorohexan-1-ol (CAS 423-46-1) is a chemical compound with the molecular formula C6H3F11O and a molecular weight of 300.07 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexan-1-ol. InChIKey: QZFZPVVDBGXQTB-UHFFFAOYSA-N.
| Molecular formula | C6H3F11O |
|---|---|
| Molecular weight | 300.07 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexan-1-ol |
| InChIKey | QZFZPVVDBGXQTB-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)