Products 181214-74-4

CAS 181214-74-4 is the registry number for Methyl perfluoropentyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-methoxypentane (CAS 181214-74-4) is a chemical compound with the molecular formula C6H3F11O and a molecular weight of 300.07 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-methoxypentane. InChIKey: FBPBXYQMWDFSOE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3F11O
Molecular weight300.07 g/mol
IUPAC name1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-methoxypentane
InChIKeyFBPBXYQMWDFSOE-UHFFFAOYSA-N
SMILESCOC(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F

Computed by PubChem (NCBI)