CAS 1661005-79-3 appears in our catalog under these names: 2,2,3,3,4,4,5,5,5-Nonafluoropentyl difluoromethyl ether, 95%, 2,2,3,3,4,4,5,5,5-Nonafluoropentyl difluoromethylether, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-(difluoromethoxy)-1,1,1,2,2,3,3,4,4-nonafluoropentane (CAS 1661005-79-3) is a chemical compound with the molecular formula C6H3F11O and a molecular weight of 300.07 g/mol. IUPAC name: 5-(difluoromethoxy)-1,1,1,2,2,3,3,4,4-nonafluoropentane. InChIKey: MWYPGZOEGJJCBI-UHFFFAOYSA-N.
| Molecular formula | C6H3F11O |
|---|---|
| Molecular weight | 300.07 g/mol |
| IUPAC name | 5-(difluoromethoxy)-1,1,1,2,2,3,3,4,4-nonafluoropentane |
| InChIKey | MWYPGZOEGJJCBI-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)OC(F)F |
Computed by PubChem (NCBI)