CAS 10001-54-4 is the registry number for 3-Isopropylbenzo[d][1,2,3]triazin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-propan-2-yl-1,2,3-benzotriazin-4-one (CAS 10001-54-4) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 3-propan-2-yl-1,2,3-benzotriazin-4-one. InChIKey: YDSIMHXQKSAODI-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 3-propan-2-yl-1,2,3-benzotriazin-4-one |
| InChIKey | YDSIMHXQKSAODI-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C2=CC=CC=C2N=N1 |
Computed by PubChem (NCBI)