Products 1000523-82-9
CAS 1000523-82-9 appears in our catalog under these names: 2-Methoxy-5-(trifluoromethyl)phenylacetic acid, 95%, 2-Methoxy-5-(trifluoromethyl)phenylacetic acid, 2-Methoxy-5-(trifluoromethyl)phenylacetic acid, 98%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 10g.
2-[2-methoxy-5-(trifluoromethyl)phenyl]acetic acid (CAS 1000523-82-9) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 2-[2-methoxy-5-(trifluoromethyl)phenyl]acetic acid. InChIKey: XWXOIMXTBVKFDL-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 2-[2-methoxy-5-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | XWXOIMXTBVKFDL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)