CAS 1000545-64-1 appears in our catalog under these names: 2-(Isoquinolin-6-yl)acetic acid, 95%, 2-(Isoquinolin-6-yl)acetic acid, 98%, 2-(Isoquinolin-6-yl)acetic acid, 2-(ISOQUINOLIN-6-YL)ACETIC ACID, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 50mg, 0,5g.
2-isoquinolin-6-ylacetic acid (CAS 1000545-64-1) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 2-isoquinolin-6-ylacetic acid. InChIKey: QBBKZWYMVFEWSI-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 2-isoquinolin-6-ylacetic acid |
| InChIKey | QBBKZWYMVFEWSI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C=C1CC(=O)O |
Computed by PubChem (NCBI)