Products 1000575-94-9
CAS 1000575-94-9 is the registry number for 2-Nitro-5-(pyrrolidin-1-yl)benzoic acid, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
2-nitro-5-pyrrolidin-1-ylbenzoic acid (CAS 1000575-94-9) is a chemical compound with the molecular formula C11H12N2O4 and a molecular weight of 236.22 g/mol. IUPAC name: 2-nitro-5-pyrrolidin-1-ylbenzoic acid. InChIKey: LNUUYCCKQBKIIJ-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 2-nitro-5-pyrrolidin-1-ylbenzoic acid |
| InChIKey | LNUUYCCKQBKIIJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC(=C(C=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)