CAS 1000577-80-9 is the registry number for 4-Bromo-2,5-difluorophenyl isothiocyanate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-2,5-difluoro-4-isothiocyanatobenzene (CAS 1000577-80-9) is a chemical compound with the molecular formula C7H2BrF2NS and a molecular weight of 250.07 g/mol. IUPAC name: 1-bromo-2,5-difluoro-4-isothiocyanatobenzene. InChIKey: DZCHDQYIMUERSQ-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF2NS |
|---|---|
| Molecular weight | 250.07 g/mol |
| IUPAC name | 1-bromo-2,5-difluoro-4-isothiocyanatobenzene |
| InChIKey | DZCHDQYIMUERSQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)N=C=S |
Computed by PubChem (NCBI)