CAS 898747-55-2 is the registry number for 2-Bromo-5,7-difluoro-1,3-benzothiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5,7-difluoro-1,3-benzothiazole (CAS 898747-55-2) is a chemical compound with the molecular formula C7H2BrF2NS and a molecular weight of 250.07 g/mol. IUPAC name: 2-bromo-5,7-difluoro-1,3-benzothiazole. InChIKey: KOBLGFWYJIAHQZ-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF2NS |
|---|---|
| Molecular weight | 250.07 g/mol |
| IUPAC name | 2-bromo-5,7-difluoro-1,3-benzothiazole |
| InChIKey | KOBLGFWYJIAHQZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=C(S2)Br)F)F |
Computed by PubChem (NCBI)