CAS 1595958-55-6 is the registry number for 1-Bromo-2,4-difluoro-5-isothiocyanatobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-2,4-difluoro-5-isothiocyanatobenzene (CAS 1595958-55-6) is a chemical compound with the molecular formula C7H2BrF2NS and a molecular weight of 250.07 g/mol. IUPAC name: 1-bromo-2,4-difluoro-5-isothiocyanatobenzene. InChIKey: VMMMODNBDNLHGF-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF2NS |
|---|---|
| Molecular weight | 250.07 g/mol |
| IUPAC name | 1-bromo-2,4-difluoro-5-isothiocyanatobenzene |
| InChIKey | VMMMODNBDNLHGF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)F)N=C=S |
Computed by PubChem (NCBI)