CAS 1080642-31-4 is the registry number for 2-Bromo-5,6-difluorobenzo[d]thiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-bromo-5,6-difluoro-1,3-benzothiazole (CAS 1080642-31-4) is a chemical compound with the molecular formula C7H2BrF2NS and a molecular weight of 250.07 g/mol. IUPAC name: 2-bromo-5,6-difluoro-1,3-benzothiazole. InChIKey: ZMKZTKLJDUUHNM-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF2NS |
|---|---|
| Molecular weight | 250.07 g/mol |
| IUPAC name | 2-bromo-5,6-difluoro-1,3-benzothiazole |
| InChIKey | ZMKZTKLJDUUHNM-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)SC(=N2)Br |
Computed by PubChem (NCBI)